About [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate
[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 50908057) has the molecular formula C19H13N3O5S
and a molecular weight of 395.40 g/mol. Its IUPAC name is [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate |
| PubChem CID | 50908057 |
| Molecular Formula | C19H13N3O5S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C19H13N3O5S/c23-17(11-10-13-6-2-1-3-7-13)27-15-9-5-4-8-14(15)18(24)21-19-20-12-16(28-19)22(25)26/h1-12H,(H,20,21,24)/b11-10+ |
| InChIKey | FUVRQMMJPYAOQW-ZHACJKMWSA-N |
| XLogP | 3.92 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate?
The IUPAC name of [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate (CID 50908057) is [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate.
What is the SMILES notation for [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate?
The canonical SMILES for [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate is O=C(/C=C/c1ccccc1)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1.
What is the InChIKey of [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate?
The InChIKey is FUVRQMMJPYAOQW-ZHACJKMWSA-N. The full InChI is InChI=1S/C19H13N3O5S/c23-17(11-10-13-6-2-1-3-7-13)27-15-9-5-4-8-14(15)18(24)21-19-20-12-16(28-19)22(25)26/h1-12H,(H,20,21,24)/b11-10+.
What are the key properties of [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate?
[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate has a molecular weight of 395.40 g/mol, XLogP of 3.92, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 50908057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).