About N-(2,5-dimorpholin-4-ylphenyl)-5-fluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine
N-(2,5-dimorpholin-4-ylphenyl)-5-fluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine (PubChem CID 50908279) has the molecular formula C29H30FN5O2
and a molecular weight of 499.59 g/mol. Its IUPAC name is N-(2,5-dimorpholin-4-ylphenyl)-5-fluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine.
Molecular Properties
| Compound Name | N-(2,5-dimorpholin-4-ylphenyl)-5-fluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine |
| PubChem CID | 50908279 |
| Molecular Formula | C29H30FN5O2 |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | N-(2,5-dimorpholin-4-ylphenyl)-5-fluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine |
| SMILES | Cc1c(-c2ccccn2)nc2cccc(F)c2c1Nc1cc(N2CCOCC2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C29H30FN5O2/c1-20-28(24-6-2-3-10-31-24)32-23-7-4-5-22(30)27(23)29(20)33-25-19-21(34-11-15-36-16-12-34)8-9-26(25)35-13-17-37-18-14-35/h2-10,19H,11-18H2,1H3,(H,32,33) |
| InChIKey | JBASCGATRIUJAA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze N-(2,5-dimorpholin-4-ylphenyl)-5-fluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dimorpholin-4-ylphenyl)-5-fluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine?
The IUPAC name of N-(2,5-dimorpholin-4-ylphenyl)-5-fluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine (CID 50908279) is N-(2,5-dimorpholin-4-ylphenyl)-5-fluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine.
What is the SMILES notation for N-(2,5-dimorpholin-4-ylphenyl)-5-fluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine?
The canonical SMILES for N-(2,5-dimorpholin-4-ylphenyl)-5-fluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine is Cc1c(-c2ccccn2)nc2cccc(F)c2c1Nc1cc(N2CCOCC2)ccc1N1CCOCC1.
What is the InChIKey of N-(2,5-dimorpholin-4-ylphenyl)-5-fluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine?
The InChIKey is JBASCGATRIUJAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H30FN5O2/c1-20-28(24-6-2-3-10-31-24)32-23-7-4-5-22(30)27(23)29(20)33-25-19-21(34-11-15-36-16-12-34)8-9-26(25)35-13-17-37-18-14-35/h2-10,19H,11-18H2,1H3,(H,32,33).
What are the key properties of N-(2,5-dimorpholin-4-ylphenyl)-5-fluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine?
N-(2,5-dimorpholin-4-ylphenyl)-5-fluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine has a molecular weight of 499.59 g/mol, XLogP of 5.16, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dimorpholin-4-ylphenyl)-5-fluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine is sourced from PubChem (CID 50908279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).