C21H18O5S — CID 50908346
[(3S)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (E)-3-thiophen-2-ylprop-2-enoate (PubChem CID 50908346) has the molecular formula C21H18O5S and a molecular weight of 382.44 g/mol. Its IUPAC name is [(3S)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (E)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | [(3S)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (E)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 50908346 |
| Molecular Formula | C21H18O5S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | [(3S)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (E)-3-thiophen-2-ylprop-2-enoate |
| SMILES | CC1(C)Oc2cc3oc(=O)ccc3cc2C[C@@H]1OC(=O)/C=C/c1cccs1 |
| InChI | InChI=1S/C21H18O5S/c1-21(2)18(25-20(23)8-6-15-4-3-9-27-15)11-14-10-13-5-7-19(22)24-16(13)12-17(14)26-21/h3-10,12,18H,11H2,1-2H3/b8-6+/t18-/m0/s1 |
| InChIKey | VTXVOGLPYWYLGQ-IWHGQQBYSA-N |
| XLogP | 4.19 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|