C15H16O3 — CID 50908403
(3aS,9bS)-6,6-dimethyl-3-methylidene-3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-2,7-dione (PubChem CID 50908403) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (3aS,9bS)-6,6-dimethyl-3-methylidene-3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-2,7-dione.
| Compound Name | (3aS,9bS)-6,6-dimethyl-3-methylidene-3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-2,7-dione |
|---|---|
| PubChem CID | 50908403 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (3aS,9bS)-6,6-dimethyl-3-methylidene-3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-2,7-dione |
| SMILES | C=C1C(=O)O[C@@H]2C3=C(CC[C@@H]12)C(C)(C)C(=O)C=C3 |
| InChI | InChI=1S/C15H16O3/c1-8-9-4-6-11-10(13(9)18-14(8)17)5-7-12(16)15(11,2)3/h5,7,9,13H,1,4,6H2,2-3H3/t9-,13-/m0/s1 |
| InChIKey | DWANJGCBTZNTTC-ZANVPECISA-N |
| XLogP | 2.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|