C21H15N3O3 — CID 50908606
11-(4-methoxyphenyl)-18-oxa-3,14,16-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2(7),3,5,8,12(17),15-heptaen-13-one (PubChem CID 50908606) has the molecular formula C21H15N3O3 and a molecular weight of 357.37 g/mol. Its IUPAC name is 11-(4-methoxyphenyl)-18-oxa-3,14,16-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2(7),3,5,8,12(17),15-heptaen-13-one.
| Compound Name | 11-(4-methoxyphenyl)-18-oxa-3,14,16-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2(7),3,5,8,12(17),15-heptaen-13-one |
|---|---|
| PubChem CID | 50908606 |
| Molecular Formula | C21H15N3O3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 11-(4-methoxyphenyl)-18-oxa-3,14,16-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2(7),3,5,8,12(17),15-heptaen-13-one |
| SMILES | COc1ccc(C2c3ccc4cccnc4c3Oc3nc[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C21H15N3O3/c1-26-14-7-4-12(5-8-14)16-15-9-6-13-3-2-10-22-18(13)19(15)27-21-17(16)20(25)23-11-24-21/h2-11,16H,1H3,(H,23,24,25) |
| InChIKey | DELFJIGJMVFNIG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |