C24H23N3O2 — CID 50908738
4-(4-methoxyphenyl)-1-(5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-7-yl)pyridin-2-one (PubChem CID 50908738) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1-(5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-7-yl)pyridin-2-one.
| Compound Name | 4-(4-methoxyphenyl)-1-(5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-7-yl)pyridin-2-one |
|---|---|
| PubChem CID | 50908738 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-(4-methoxyphenyl)-1-(5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-7-yl)pyridin-2-one |
| SMILES | COc1ccc(-c2ccn(-c3ccc4c5c(n(C)c4c3)CCNC5)c(=O)c2)cc1 |
| InChI | InChI=1S/C24H23N3O2/c1-26-22-9-11-25-15-21(22)20-8-5-18(14-23(20)26)27-12-10-17(13-24(27)28)16-3-6-19(29-2)7-4-16/h3-8,10,12-14,25H,9,11,15H2,1-2H3 |
| InChIKey | JJKWGJGBEJMMMY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|