C15H24N5O4P — CID 50908761
1-bis(morpholin-4-ylamino)phosphoryl-N-phenylformamide (PubChem CID 50908761) has the molecular formula C15H24N5O4P and a molecular weight of 369.36 g/mol. Its IUPAC name is 1-bis(morpholin-4-ylamino)phosphoryl-N-phenylformamide.
| Compound Name | 1-bis(morpholin-4-ylamino)phosphoryl-N-phenylformamide |
|---|---|
| PubChem CID | 50908761 |
| Molecular Formula | C15H24N5O4P |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 1-bis(morpholin-4-ylamino)phosphoryl-N-phenylformamide |
| SMILES | O=C(Nc1ccccc1)P(=O)(NN1CCOCC1)NN1CCOCC1 |
| InChI | InChI=1S/C15H24N5O4P/c21-15(16-14-4-2-1-3-5-14)25(22,17-19-6-10-23-11-7-19)18-20-8-12-24-13-9-20/h1-5H,6-13H2,(H,16,21)(H2,17,18,22) |
| InChIKey | CORFAZVEBDQSKP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|