C31H43ClN4O3 — CID 50908869
(2S)-N-[(5-chloro-2-prop-2-enyl-1H-indol-3-yl)methyl]-2-[[(2R)-2-cyclohexyl-2-(pent-4-enoylamino)acetyl]amino]-4-methylpentanamide (PubChem CID 50908869) has the molecular formula C31H43ClN4O3 and a molecular weight of 555.16 g/mol. Its IUPAC name is (2S)-N-[(5-chloro-2-prop-2-enyl-1H-indol-3-yl)methyl]-2-[[(2R)-2-cyclohexyl-2-(pent-4-enoylamino)acetyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-N-[(5-chloro-2-prop-2-enyl-1H-indol-3-yl)methyl]-2-[[(2R)-2-cyclohexyl-2-(pent-4-enoylamino)acetyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 50908869 |
| Molecular Formula | C31H43ClN4O3 |
| Molecular Weight | 555.16 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | (2S)-N-[(5-chloro-2-prop-2-enyl-1H-indol-3-yl)methyl]-2-[[(2R)-2-cyclohexyl-2-(pent-4-enoylamino)acetyl]amino]-4-methylpentanamide |
| SMILES | C=CCCC(=O)N[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)NCc1c(CC=C)[nH]c2ccc(Cl)cc12)C1CCCCC1 |
| InChI | InChI=1S/C31H43ClN4O3/c1-5-7-14-28(37)36-29(21-12-9-8-10-13-21)31(39)35-27(17-20(3)4)30(38)33-19-24-23-18-22(32)15-16-26(23)34-25(24)11-6-2/h5-6,15-16,18,20-21,27,29,34H,1-2,7-14,17,19H2,3-4H3,(H,33,38)(H,35,39)(H,36,37)/t27-,29+/m0/s1 |
| InChIKey | DULADXSFGCQPEO-LMSSTIIKSA-N |
| XLogP | 5.73 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.16 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|