C23H19F2N3O3S — CID 50908900
N-[3-(N-(1,1-dioxo-1,2-benzothiazol-3-yl)-2-fluoroanilino)propyl]-4-fluorobenzamide (PubChem CID 50908900) has the molecular formula C23H19F2N3O3S and a molecular weight of 455.49 g/mol. Its IUPAC name is N-[3-(N-(1,1-dioxo-1,2-benzothiazol-3-yl)-2-fluoroanilino)propyl]-4-fluorobenzamide.
| Compound Name | N-[3-(N-(1,1-dioxo-1,2-benzothiazol-3-yl)-2-fluoroanilino)propyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 50908900 |
| Molecular Formula | C23H19F2N3O3S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-[3-(N-(1,1-dioxo-1,2-benzothiazol-3-yl)-2-fluoroanilino)propyl]-4-fluorobenzamide |
| SMILES | O=C(NCCCN(C1=NS(=O)(=O)c2ccccc21)c1ccccc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H19F2N3O3S/c24-17-12-10-16(11-13-17)23(29)26-14-5-15-28(20-8-3-2-7-19(20)25)22-18-6-1-4-9-21(18)32(30,31)27-22/h1-4,6-13H,5,14-15H2,(H,26,29) |
| InChIKey | BBAUCSHFDJAQLB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|