C23H27NO3 — CID 50909057
[(1S,9S,13S)-10-(furan-3-ylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] 2-methylprop-2-enoate (PubChem CID 50909057) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is [(1S,9S,13S)-10-(furan-3-ylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] 2-methylprop-2-enoate.
| Compound Name | [(1S,9S,13S)-10-(furan-3-ylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 50909057 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [(1S,9S,13S)-10-(furan-3-ylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc2c(c1)[C@@]1(C)CCN(Cc3ccoc3)[C@@H](C2)[C@H]1C |
| InChI | InChI=1S/C23H27NO3/c1-15(2)22(25)27-19-6-5-18-11-21-16(3)23(4,20(18)12-19)8-9-24(21)13-17-7-10-26-14-17/h5-7,10,12,14,16,21H,1,8-9,11,13H2,2-4H3/t16-,21+,23+/m1/s1 |
| InChIKey | GLKBBDDBLQKTGS-HNKPZJSLSA-N |
| XLogP | 4.49 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|