C22H39NO9 — CID 50909225
N,N-diethyl-2-[[(1R,3R,4R,5R)-4,7,7-trimethyl-6-oxabicyclo[3.2.1]octan-3-yl]oxy]ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 50909225) has the molecular formula C22H39NO9 and a molecular weight of 461.55 g/mol. Its IUPAC name is N,N-diethyl-2-[[(1R,3R,4R,5R)-4,7,7-trimethyl-6-oxabicyclo[3.2.1]octan-3-yl]oxy]ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | N,N-diethyl-2-[[(1R,3R,4R,5R)-4,7,7-trimethyl-6-oxabicyclo[3.2.1]octan-3-yl]oxy]ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 50909225 |
| Molecular Formula | C22H39NO9 |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | N,N-diethyl-2-[[(1R,3R,4R,5R)-4,7,7-trimethyl-6-oxabicyclo[3.2.1]octan-3-yl]oxy]ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCN(CC)CCO[C@@H]1C[C@@H]2C[C@@H](OC2(C)C)[C@@H]1C.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H31NO2.C6H8O7/c1-6-17(7-2)8-9-18-14-10-13-11-15(12(14)3)19-16(13,4)5;7-3(8)1-6(13,5(11)12)2-4(9)10/h12-15H,6-11H2,1-5H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t12-,13-,14-,15-;/m1./s1 |
| InChIKey | ZHSQYLKQNIKDNR-JODQJINJSA-N |
| XLogP | 1.69 |
| TPSA | 153.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |