About bis(pyridin-4-ylmethanol);tetrachloroplatinum
bis(pyridin-4-ylmethanol);tetrachloroplatinum (PubChem CID 50909507) has the molecular formula C12H14Cl4N2O2Pt
and a molecular weight of 555.15 g/mol. Its IUPAC name is bis(pyridin-4-ylmethanol);tetrachloroplatinum.
Molecular Properties
| Compound Name | bis(pyridin-4-ylmethanol);tetrachloroplatinum |
| PubChem CID | 50909507 |
| Molecular Formula | C12H14Cl4N2O2Pt |
| Molecular Weight | 555.15 g/mol |
| Exact Mass | 552.95 |
| IUPAC Name | bis(pyridin-4-ylmethanol);tetrachloroplatinum |
| SMILES | Cl[Pt](Cl)(Cl)Cl.OCc1ccncc1.OCc1ccncc1 |
| InChI | InChI=1S/2C6H7NO.4ClH.Pt/c2*8-5-6-1-3-7-4-2-6;;;;;/h2*1-4,8H,5H2;4*1H;/q;;;;;;+4/p-4 |
| InChIKey | MJOHRUHBFXVLLR-UHFFFAOYSA-J |
| XLogP | 3.90 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 555.15 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(pyridin-4-ylmethanol);tetrachloroplatinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(pyridin-4-ylmethanol);tetrachloroplatinum?
The IUPAC name of bis(pyridin-4-ylmethanol);tetrachloroplatinum (CID 50909507) is bis(pyridin-4-ylmethanol);tetrachloroplatinum.
What is the SMILES notation for bis(pyridin-4-ylmethanol);tetrachloroplatinum?
The canonical SMILES for bis(pyridin-4-ylmethanol);tetrachloroplatinum is Cl[Pt](Cl)(Cl)Cl.OCc1ccncc1.OCc1ccncc1.
What is the InChIKey of bis(pyridin-4-ylmethanol);tetrachloroplatinum?
The InChIKey is MJOHRUHBFXVLLR-UHFFFAOYSA-J. The full InChI is InChI=1S/2C6H7NO.4ClH.Pt/c2*8-5-6-1-3-7-4-2-6;;;;;/h2*1-4,8H,5H2;4*1H;/q;;;;;;+4/p-4.
What are the key properties of bis(pyridin-4-ylmethanol);tetrachloroplatinum?
bis(pyridin-4-ylmethanol);tetrachloroplatinum has a molecular weight of 555.15 g/mol, XLogP of 3.90, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(pyridin-4-ylmethanol);tetrachloroplatinum is sourced from PubChem (CID 50909507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).