About 2-[2-aminoethyl(2-azanidylethyl)amino]ethylazanide;chloroplatinum(1+)
2-[2-aminoethyl(2-azanidylethyl)amino]ethylazanide;chloroplatinum(1+) (PubChem CID 50909768) has the molecular formula C6H16ClN4Pt-
and a molecular weight of 374.75 g/mol. Its IUPAC name is 2-[2-aminoethyl(2-azanidylethyl)amino]ethylazanide;chloroplatinum(1+).
Molecular Properties
| Compound Name | 2-[2-aminoethyl(2-azanidylethyl)amino]ethylazanide;chloroplatinum(1+) |
| PubChem CID | 50909768 |
| Molecular Formula | C6H16ClN4Pt- |
| Molecular Weight | 374.75 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 2-[2-aminoethyl(2-azanidylethyl)amino]ethylazanide;chloroplatinum(1+) |
| SMILES | Cl[Pt+].[NH-]CCN(CC[NH-])CCN |
| InChI | InChI=1S/C6H16N4.ClH.Pt/c7-1-4-10(5-2-8)6-3-9;;/h7-8H,1-6,9H2;1H;/q-2;;+2/p-1 |
| InChIKey | FEXIFNSGOLHSDK-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.75 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-aminoethyl(2-azanidylethyl)amino]ethylazanide;chloroplatinum(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-aminoethyl(2-azanidylethyl)amino]ethylazanide;chloroplatinum(1+)?
The IUPAC name of 2-[2-aminoethyl(2-azanidylethyl)amino]ethylazanide;chloroplatinum(1+) (CID 50909768) is 2-[2-aminoethyl(2-azanidylethyl)amino]ethylazanide;chloroplatinum(1+).
What is the SMILES notation for 2-[2-aminoethyl(2-azanidylethyl)amino]ethylazanide;chloroplatinum(1+)?
The canonical SMILES for 2-[2-aminoethyl(2-azanidylethyl)amino]ethylazanide;chloroplatinum(1+) is Cl[Pt+].[NH-]CCN(CC[NH-])CCN.
What is the InChIKey of 2-[2-aminoethyl(2-azanidylethyl)amino]ethylazanide;chloroplatinum(1+)?
The InChIKey is FEXIFNSGOLHSDK-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H16N4.ClH.Pt/c7-1-4-10(5-2-8)6-3-9;;/h7-8H,1-6,9H2;1H;/q-2;;+2/p-1.
What are the key properties of 2-[2-aminoethyl(2-azanidylethyl)amino]ethylazanide;chloroplatinum(1+)?
2-[2-aminoethyl(2-azanidylethyl)amino]ethylazanide;chloroplatinum(1+) has a molecular weight of 374.75 g/mol, XLogP of 1.04, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-aminoethyl(2-azanidylethyl)amino]ethylazanide;chloroplatinum(1+) is sourced from PubChem (CID 50909768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).