copper 2-azanidylethyl-[2-(2-azanidylethylazanidyl)ethyl]azanide

C6H14CuN4-2 — CID 50910638

IUPACcopper 2-azanidylethyl-[2-(2-azanidylethylazanidyl)ethyl]azanide
SMILES[Cu+2].[NH-]CC[N-]CC[N-]CC[NH-]
InChIInChI=1S/C6H14N4.Cu/c7-1-3-9-5-6-10-4-2-8;/h7-8H,1-6H2;/q-4;+2
InChIKeyKNKRPKHYZYPHTR-UHFFFAOYSA-N
MW205.75 g/mol
LogP1.84
Rot. Bonds7

About copper 2-azanidylethyl-[2-(2-azanidylethylazanidyl)ethyl]azanide

copper 2-azanidylethyl-[2-(2-azanidylethylazanidyl)ethyl]azanide (PubChem CID 50910638) has the molecular formula C6H14CuN4-2 and a molecular weight of 205.75 g/mol. Its IUPAC name is copper 2-azanidylethyl-[2-(2-azanidylethylazanidyl)ethyl]azanide.

Molecular Properties

Compound Namecopper 2-azanidylethyl-[2-(2-azanidylethylazanidyl)ethyl]azanide
PubChem CID50910638
Molecular FormulaC6H14CuN4-2
Molecular Weight205.75 g/mol
Exact Mass205.05
IUPAC Namecopper 2-azanidylethyl-[2-(2-azanidylethylazanidyl)ethyl]azanide
SMILES[Cu+2].[NH-]CC[N-]CC[N-]CC[NH-]
InChIInChI=1S/C6H14N4.Cu/c7-1-3-9-5-6-10-4-2-8;/h7-8H,1-6H2;/q-4;+2
InChIKeyKNKRPKHYZYPHTR-UHFFFAOYSA-N
XLogP1.84
TPSA75.80 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds7
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.75
LogP ≤ 51.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze copper 2-azanidylethyl-[2-(2-azanidylethylazanidyl)ethyl]azanide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of copper 2-azanidylethyl-[2-(2-azanidylethylazanidyl)ethyl]azanide?
The IUPAC name of copper 2-azanidylethyl-[2-(2-azanidylethylazanidyl)ethyl]azanide (CID 50910638) is copper 2-azanidylethyl-[2-(2-azanidylethylazanidyl)ethyl]azanide.
What is the SMILES notation for copper 2-azanidylethyl-[2-(2-azanidylethylazanidyl)ethyl]azanide?
The canonical SMILES for copper 2-azanidylethyl-[2-(2-azanidylethylazanidyl)ethyl]azanide is [Cu+2].[NH-]CC[N-]CC[N-]CC[NH-].
What is the InChIKey of copper 2-azanidylethyl-[2-(2-azanidylethylazanidyl)ethyl]azanide?
The InChIKey is KNKRPKHYZYPHTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N4.Cu/c7-1-3-9-5-6-10-4-2-8;/h7-8H,1-6H2;/q-4;+2.
What are the key properties of copper 2-azanidylethyl-[2-(2-azanidylethylazanidyl)ethyl]azanide?
copper 2-azanidylethyl-[2-(2-azanidylethylazanidyl)ethyl]azanide has a molecular weight of 205.75 g/mol, XLogP of 1.84, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for copper 2-azanidylethyl-[2-(2-azanidylethylazanidyl)ethyl]azanide is sourced from PubChem (CID 50910638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).