About (1-carboxy-3-methylsulfoniopropyl)azanide;dibromopalladium
(1-carboxy-3-methylsulfoniopropyl)azanide;dibromopalladium (PubChem CID 50910688) has the molecular formula C5H11Br2NO2PdS
and a molecular weight of 415.44 g/mol. Its IUPAC name is (1-carboxy-3-methylsulfoniopropyl)azanide;dibromopalladium.
Molecular Properties
| Compound Name | (1-carboxy-3-methylsulfoniopropyl)azanide;dibromopalladium |
| PubChem CID | 50910688 |
| Molecular Formula | C5H11Br2NO2PdS |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 412.79 |
| IUPAC Name | (1-carboxy-3-methylsulfoniopropyl)azanide;dibromopalladium |
| SMILES | Br[Pd]Br.C[SH+]CCC([NH-])C(=O)O |
| InChI | InChI=1S/C5H10NO2S.2BrH.Pd/c1-9-3-2-4(6)5(7)8;;;/h4,6H,2-3H2,1H3,(H,7,8);2*1H;/q-1;;;+2/p-1 |
| InChIKey | PTXZSVWCBPESOZ-UHFFFAOYSA-M |
| XLogP | 2.02 |
| TPSA | 61.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (1-carboxy-3-methylsulfoniopropyl)azanide;dibromopalladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-carboxy-3-methylsulfoniopropyl)azanide;dibromopalladium?
The IUPAC name of (1-carboxy-3-methylsulfoniopropyl)azanide;dibromopalladium (CID 50910688) is (1-carboxy-3-methylsulfoniopropyl)azanide;dibromopalladium.
What is the SMILES notation for (1-carboxy-3-methylsulfoniopropyl)azanide;dibromopalladium?
The canonical SMILES for (1-carboxy-3-methylsulfoniopropyl)azanide;dibromopalladium is Br[Pd]Br.C[SH+]CCC([NH-])C(=O)O.
What is the InChIKey of (1-carboxy-3-methylsulfoniopropyl)azanide;dibromopalladium?
The InChIKey is PTXZSVWCBPESOZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10NO2S.2BrH.Pd/c1-9-3-2-4(6)5(7)8;;;/h4,6H,2-3H2,1H3,(H,7,8);2*1H;/q-1;;;+2/p-1.
What are the key properties of (1-carboxy-3-methylsulfoniopropyl)azanide;dibromopalladium?
(1-carboxy-3-methylsulfoniopropyl)azanide;dibromopalladium has a molecular weight of 415.44 g/mol, XLogP of 2.02, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-carboxy-3-methylsulfoniopropyl)azanide;dibromopalladium is sourced from PubChem (CID 50910688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).