C20H34O5 — CID 50911025
[(5S)-dec-1-en-5-yl] (2E,4R,5R,7S)-4,5,7-trihydroxydeca-2,9-dienoate (PubChem CID 50911025) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is [(5S)-dec-1-en-5-yl] (2E,4R,5R,7S)-4,5,7-trihydroxydeca-2,9-dienoate.
| Compound Name | [(5S)-dec-1-en-5-yl] (2E,4R,5R,7S)-4,5,7-trihydroxydeca-2,9-dienoate |
|---|---|
| PubChem CID | 50911025 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | [(5S)-dec-1-en-5-yl] (2E,4R,5R,7S)-4,5,7-trihydroxydeca-2,9-dienoate |
| SMILES | C=CCC[C@H](CCCCC)OC(=O)/C=C/[C@@H](O)[C@H](O)C[C@@H](O)CC=C |
| InChI | InChI=1S/C20H34O5/c1-4-7-9-12-17(11-8-5-2)25-20(24)14-13-18(22)19(23)15-16(21)10-6-3/h5-6,13-14,16-19,21-23H,2-4,7-12,15H2,1H3/b14-13+/t16-,17+,18+,19+/m0/s1 |
| InChIKey | PBHMXJVEZSAGND-QXAASWJWSA-N |
| XLogP | 3.05 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|