C21H20O4S2 — CID 50911044
(1S,5S,8R,9S)-5,8,9-trihydroxy-1,3-bis(phenylsulfanyl)bicyclo[3.3.1]non-3-en-2-one (PubChem CID 50911044) has the molecular formula C21H20O4S2 and a molecular weight of 400.52 g/mol. Its IUPAC name is (1S,5S,8R,9S)-5,8,9-trihydroxy-1,3-bis(phenylsulfanyl)bicyclo[3.3.1]non-3-en-2-one.
| Compound Name | (1S,5S,8R,9S)-5,8,9-trihydroxy-1,3-bis(phenylsulfanyl)bicyclo[3.3.1]non-3-en-2-one |
|---|---|
| PubChem CID | 50911044 |
| Molecular Formula | C21H20O4S2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | (1S,5S,8R,9S)-5,8,9-trihydroxy-1,3-bis(phenylsulfanyl)bicyclo[3.3.1]non-3-en-2-one |
| SMILES | O=C1C(Sc2ccccc2)=C[C@@]2(O)CC[C@@H](O)[C@]1(Sc1ccccc1)[C@H]2O |
| InChI | InChI=1S/C21H20O4S2/c22-17-11-12-20(25)13-16(26-14-7-3-1-4-8-14)18(23)21(17,19(20)24)27-15-9-5-2-6-10-15/h1-10,13,17,19,22,24-25H,11-12H2/t17-,19+,20+,21-/m1/s1 |
| InChIKey | SNQTVVDLJPSGSV-BVOGOJNSSA-N |
| XLogP | 3.02 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |