C22H25N3O3 — CID 50911075
(2R,4R,6R)-2-(4-methoxyphenyl)-6-[2-(4-phenyltriazol-1-yl)ethyl]oxan-4-ol (PubChem CID 50911075) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is (2R,4R,6R)-2-(4-methoxyphenyl)-6-[2-(4-phenyltriazol-1-yl)ethyl]oxan-4-ol.
| Compound Name | (2R,4R,6R)-2-(4-methoxyphenyl)-6-[2-(4-phenyltriazol-1-yl)ethyl]oxan-4-ol |
|---|---|
| PubChem CID | 50911075 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (2R,4R,6R)-2-(4-methoxyphenyl)-6-[2-(4-phenyltriazol-1-yl)ethyl]oxan-4-ol |
| SMILES | COc1ccc([C@H]2C[C@H](O)C[C@@H](CCn3cc(-c4ccccc4)nn3)O2)cc1 |
| InChI | InChI=1S/C22H25N3O3/c1-27-19-9-7-17(8-10-19)22-14-18(26)13-20(28-22)11-12-25-15-21(23-24-25)16-5-3-2-4-6-16/h2-10,15,18,20,22,26H,11-14H2,1H3/t18-,20-,22-/m1/s1 |
| InChIKey | JYHDNDXFIQYMDQ-SYYKKAFVSA-N |
| XLogP | 3.62 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |