About dichloro(diphenyl)stannane;5,6-dimethyl-1,10-phenanthroline
dichloro(diphenyl)stannane;5,6-dimethyl-1,10-phenanthroline (PubChem CID 50911786) has the molecular formula C26H22Cl2N2Sn
and a molecular weight of 552.09 g/mol. Its IUPAC name is dichloro(diphenyl)stannane;5,6-dimethyl-1,10-phenanthroline.
Molecular Properties
| Compound Name | dichloro(diphenyl)stannane;5,6-dimethyl-1,10-phenanthroline |
| PubChem CID | 50911786 |
| Molecular Formula | C26H22Cl2N2Sn |
| Molecular Weight | 552.09 g/mol |
| Exact Mass | 552.02 |
| IUPAC Name | dichloro(diphenyl)stannane;5,6-dimethyl-1,10-phenanthroline |
| SMILES | Cc1c(C)c2cccnc2c2ncccc12.Cl[Sn](Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12N2.2C6H5.2ClH.Sn/c1-9-10(2)12-6-4-8-16-14(12)13-11(9)5-3-7-15-13;2*1-2-4-6-5-3-1;;;/h3-8H,1-2H3;2*1-5H;2*1H;/q;;;;;+2/p-2 |
| InChIKey | XPEIAVVBGGYDGZ-UHFFFAOYSA-L |
| XLogP | 6.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 552.09 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze dichloro(diphenyl)stannane;5,6-dimethyl-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(diphenyl)stannane;5,6-dimethyl-1,10-phenanthroline?
The IUPAC name of dichloro(diphenyl)stannane;5,6-dimethyl-1,10-phenanthroline (CID 50911786) is dichloro(diphenyl)stannane;5,6-dimethyl-1,10-phenanthroline.
What is the SMILES notation for dichloro(diphenyl)stannane;5,6-dimethyl-1,10-phenanthroline?
The canonical SMILES for dichloro(diphenyl)stannane;5,6-dimethyl-1,10-phenanthroline is Cc1c(C)c2cccnc2c2ncccc12.Cl[Sn](Cl)(c1ccccc1)c1ccccc1.
What is the InChIKey of dichloro(diphenyl)stannane;5,6-dimethyl-1,10-phenanthroline?
The InChIKey is XPEIAVVBGGYDGZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H12N2.2C6H5.2ClH.Sn/c1-9-10(2)12-6-4-8-16-14(12)13-11(9)5-3-7-15-13;2*1-2-4-6-5-3-1;;;/h3-8H,1-2H3;2*1-5H;2*1H;/q;;;;;+2/p-2.
What are the key properties of dichloro(diphenyl)stannane;5,6-dimethyl-1,10-phenanthroline?
dichloro(diphenyl)stannane;5,6-dimethyl-1,10-phenanthroline has a molecular weight of 552.09 g/mol, XLogP of 6.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(diphenyl)stannane;5,6-dimethyl-1,10-phenanthroline is sourced from PubChem (CID 50911786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).