About bis(2-aminoethyl)azanide;trichlorochromium(1+)
bis(2-aminoethyl)azanide;trichlorochromium(1+) (PubChem CID 50912722) has the molecular formula C4H12Cl3CrN3
and a molecular weight of 260.52 g/mol. Its IUPAC name is bis(2-aminoethyl)azanide;trichlorochromium(1+).
Molecular Properties
| Compound Name | bis(2-aminoethyl)azanide;trichlorochromium(1+) |
| PubChem CID | 50912722 |
| Molecular Formula | C4H12Cl3CrN3 |
| Molecular Weight | 260.52 g/mol |
| Exact Mass | 258.95 |
| IUPAC Name | bis(2-aminoethyl)azanide;trichlorochromium(1+) |
| SMILES | Cl[Cr+](Cl)Cl.NCC[N-]CCN |
| InChI | InChI=1S/C4H12N3.3ClH.Cr/c5-1-3-7-4-2-6;;;;/h1-6H2;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | QUQXXENXCJNCMQ-UHFFFAOYSA-K |
| XLogP | 1.34 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.52 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-aminoethyl)azanide;trichlorochromium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-aminoethyl)azanide;trichlorochromium(1+)?
The IUPAC name of bis(2-aminoethyl)azanide;trichlorochromium(1+) (CID 50912722) is bis(2-aminoethyl)azanide;trichlorochromium(1+).
What is the SMILES notation for bis(2-aminoethyl)azanide;trichlorochromium(1+)?
The canonical SMILES for bis(2-aminoethyl)azanide;trichlorochromium(1+) is Cl[Cr+](Cl)Cl.NCC[N-]CCN.
What is the InChIKey of bis(2-aminoethyl)azanide;trichlorochromium(1+)?
The InChIKey is QUQXXENXCJNCMQ-UHFFFAOYSA-K. The full InChI is InChI=1S/C4H12N3.3ClH.Cr/c5-1-3-7-4-2-6;;;;/h1-6H2;3*1H;/q-1;;;;+4/p-3.
What are the key properties of bis(2-aminoethyl)azanide;trichlorochromium(1+)?
bis(2-aminoethyl)azanide;trichlorochromium(1+) has a molecular weight of 260.52 g/mol, XLogP of 1.34, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-aminoethyl)azanide;trichlorochromium(1+) is sourced from PubChem (CID 50912722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).