C22H25FN2O2 — CID 50913028
(1S,9S,10S)-5-(5-fluoro-2-hydroxyanilino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol (PubChem CID 50913028) has the molecular formula C22H25FN2O2 and a molecular weight of 368.45 g/mol. Its IUPAC name is (1S,9S,10S)-5-(5-fluoro-2-hydroxyanilino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol.
| Compound Name | (1S,9S,10S)-5-(5-fluoro-2-hydroxyanilino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 50913028 |
| Molecular Formula | C22H25FN2O2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (1S,9S,10S)-5-(5-fluoro-2-hydroxyanilino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
| SMILES | Oc1ccc(F)cc1Nc1cc2c(cc1O)[C@]13CCCC[C@@H]1[C@H](C2)NCC3 |
| InChI | InChI=1S/C22H25FN2O2/c23-14-4-5-20(26)19(11-14)25-18-10-13-9-17-15-3-1-2-6-22(15,7-8-24-17)16(13)12-21(18)27/h4-5,10-12,15,17,24-27H,1-3,6-9H2/t15-,17+,22+/m1/s1 |
| InChIKey | AZMGQIJXLACKFO-ZWWNWMABSA-N |
| XLogP | 4.33 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|