About 6-(2-phenylethynyl)-[1,2,4]triazolo[1,5-a]pyrimidine
6-(2-phenylethynyl)-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 50913149) has the molecular formula C13H8N4
and a molecular weight of 220.24 g/mol. Its IUPAC name is 6-(2-phenylethynyl)-[1,2,4]triazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 6-(2-phenylethynyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| PubChem CID | 50913149 |
| Molecular Formula | C13H8N4 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 6-(2-phenylethynyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | C(#Cc1cnc2ncnn2c1)c1ccccc1 |
| InChI | InChI=1S/C13H8N4/c1-2-4-11(5-3-1)6-7-12-8-14-13-15-10-16-17(13)9-12/h1-5,8-10H |
| InChIKey | AHHQDWYUBOVTAN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-phenylethynyl)-[1,2,4]triazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-phenylethynyl)-[1,2,4]triazolo[1,5-a]pyrimidine?
The IUPAC name of 6-(2-phenylethynyl)-[1,2,4]triazolo[1,5-a]pyrimidine (CID 50913149) is 6-(2-phenylethynyl)-[1,2,4]triazolo[1,5-a]pyrimidine.
What is the SMILES notation for 6-(2-phenylethynyl)-[1,2,4]triazolo[1,5-a]pyrimidine?
The canonical SMILES for 6-(2-phenylethynyl)-[1,2,4]triazolo[1,5-a]pyrimidine is C(#Cc1cnc2ncnn2c1)c1ccccc1.
What is the InChIKey of 6-(2-phenylethynyl)-[1,2,4]triazolo[1,5-a]pyrimidine?
The InChIKey is AHHQDWYUBOVTAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N4/c1-2-4-11(5-3-1)6-7-12-8-14-13-15-10-16-17(13)9-12/h1-5,8-10H.
What are the key properties of 6-(2-phenylethynyl)-[1,2,4]triazolo[1,5-a]pyrimidine?
6-(2-phenylethynyl)-[1,2,4]triazolo[1,5-a]pyrimidine has a molecular weight of 220.24 g/mol, XLogP of 1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-phenylethynyl)-[1,2,4]triazolo[1,5-a]pyrimidine is sourced from PubChem (CID 50913149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).