C23H25F3N2O — CID 50913170
(1S,9S,10S)-5-[2-(trifluoromethyl)anilino]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol (PubChem CID 50913170) has the molecular formula C23H25F3N2O and a molecular weight of 402.46 g/mol. Its IUPAC name is (1S,9S,10S)-5-[2-(trifluoromethyl)anilino]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol.
| Compound Name | (1S,9S,10S)-5-[2-(trifluoromethyl)anilino]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 50913170 |
| Molecular Formula | C23H25F3N2O |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (1S,9S,10S)-5-[2-(trifluoromethyl)anilino]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
| SMILES | Oc1cc2c(cc1Nc1ccccc1C(F)(F)F)C[C@@H]1NCC[C@]23CCCC[C@H]13 |
| InChI | InChI=1S/C23H25F3N2O/c24-23(25,26)16-6-1-2-7-18(16)28-20-12-14-11-19-15-5-3-4-8-22(15,9-10-27-19)17(14)13-21(20)29/h1-2,6-7,12-13,15,19,27-29H,3-5,8-11H2/t15-,19+,22+/m1/s1 |
| InChIKey | QUOVUDIQHSMXOX-MPHOGZCYSA-N |
| XLogP | 5.50 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|