C18H25F2N3O2 — CID 50913264
[(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(4-ethoxy-5,5-difluoro-1,4,6,7-tetrahydroindol-2-yl)methanone (PubChem CID 50913264) has the molecular formula C18H25F2N3O2 and a molecular weight of 353.41 g/mol. Its IUPAC name is [(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(4-ethoxy-5,5-difluoro-1,4,6,7-tetrahydroindol-2-yl)methanone.
| Compound Name | [(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(4-ethoxy-5,5-difluoro-1,4,6,7-tetrahydroindol-2-yl)methanone |
|---|---|
| PubChem CID | 50913264 |
| Molecular Formula | C18H25F2N3O2 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | [(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(4-ethoxy-5,5-difluoro-1,4,6,7-tetrahydroindol-2-yl)methanone |
| SMILES | CCOC1c2cc(C(=O)N3C[C@H]4CCCN[C@H]4C3)[nH]c2CCC1(F)F |
| InChI | InChI=1S/C18H25F2N3O2/c1-2-25-16-12-8-14(22-13(12)5-6-18(16,19)20)17(24)23-9-11-4-3-7-21-15(11)10-23/h8,11,15-16,21-22H,2-7,9-10H2,1H3/t11-,15+,16?/m1/s1 |
| InChIKey | ZVZMBMHNSMKQBO-LKCRCUOOSA-N |
| XLogP | 2.50 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |