About 1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one
1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one (PubChem CID 5091381) has the molecular formula C9H12Cl2N2O
and a molecular weight of 235.11 g/mol. Its IUPAC name is 1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one.
Molecular Properties
| Compound Name | 1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one |
| PubChem CID | 5091381 |
| Molecular Formula | C9H12Cl2N2O |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)Cn1cnc(Cl)c1Cl |
| InChI | InChI=1S/C9H12Cl2N2O/c1-9(2,3)6(14)4-13-5-12-7(10)8(13)11/h5H,4H2,1-3H3 |
| InChIKey | BGKMCAYBCDYDHG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one?
The IUPAC name of 1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one (CID 5091381) is 1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one.
What is the SMILES notation for 1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one?
The canonical SMILES for 1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one is CC(C)(C)C(=O)Cn1cnc(Cl)c1Cl.
What is the InChIKey of 1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one?
The InChIKey is BGKMCAYBCDYDHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Cl2N2O/c1-9(2,3)6(14)4-13-5-12-7(10)8(13)11/h5H,4H2,1-3H3.
What are the key properties of 1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one?
1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one has a molecular weight of 235.11 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one is sourced from PubChem (CID 5091381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).