C20H16F3N5 — CID 50914114
7-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]imidazo[1,2-b][1,2,4]triazine (PubChem CID 50914114) has the molecular formula C20H16F3N5 and a molecular weight of 392.43 g/mol. Its IUPAC name is 7-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]imidazo[1,2-b][1,2,4]triazine.
| Compound Name | 7-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]imidazo[1,2-b][1,2,4]triazine |
|---|---|
| PubChem CID | 50914114 |
| Molecular Formula | C20H16F3N5 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 7-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]imidazo[1,2-b][1,2,4]triazine |
| SMILES | [2H]C([2H])([2H])C(c1cnn2c(-c3ccc(F)c(-c4ncc(F)cc4F)c3)cnc2n1)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C20H16F3N5/c1-20(2,3)17-10-26-28-16(9-25-19(28)27-17)11-4-5-14(22)13(6-11)18-15(23)7-12(21)8-24-18/h4-10H,1-3H3/i1D3,2D3,3D3 |
| InChIKey | VSFOMSPQWAXALX-GQALSZNTSA-N |
| XLogP | 4.57 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |