About 4-(2,2-dichloroethenyl)-5,5-dimethyloxolan-2-one
4-(2,2-dichloroethenyl)-5,5-dimethyloxolan-2-one (PubChem CID 5091449) has the molecular formula C8H10Cl2O2
and a molecular weight of 209.07 g/mol. Its IUPAC name is 4-(2,2-dichloroethenyl)-5,5-dimethyloxolan-2-one.
Molecular Properties
| Compound Name | 4-(2,2-dichloroethenyl)-5,5-dimethyloxolan-2-one |
| PubChem CID | 5091449 |
| Molecular Formula | C8H10Cl2O2 |
| Molecular Weight | 209.07 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 4-(2,2-dichloroethenyl)-5,5-dimethyloxolan-2-one |
| SMILES | CC1(C)OC(=O)CC1C=C(Cl)Cl |
| InChI | InChI=1S/C8H10Cl2O2/c1-8(2)5(3-6(9)10)4-7(11)12-8/h3,5H,4H2,1-2H3 |
| InChIKey | COKNOMNYGGDKQI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.07 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,2-dichloroethenyl)-5,5-dimethyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dichloroethenyl)-5,5-dimethyloxolan-2-one?
The IUPAC name of 4-(2,2-dichloroethenyl)-5,5-dimethyloxolan-2-one (CID 5091449) is 4-(2,2-dichloroethenyl)-5,5-dimethyloxolan-2-one.
What is the SMILES notation for 4-(2,2-dichloroethenyl)-5,5-dimethyloxolan-2-one?
The canonical SMILES for 4-(2,2-dichloroethenyl)-5,5-dimethyloxolan-2-one is CC1(C)OC(=O)CC1C=C(Cl)Cl.
What is the InChIKey of 4-(2,2-dichloroethenyl)-5,5-dimethyloxolan-2-one?
The InChIKey is COKNOMNYGGDKQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10Cl2O2/c1-8(2)5(3-6(9)10)4-7(11)12-8/h3,5H,4H2,1-2H3.
What are the key properties of 4-(2,2-dichloroethenyl)-5,5-dimethyloxolan-2-one?
4-(2,2-dichloroethenyl)-5,5-dimethyloxolan-2-one has a molecular weight of 209.07 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dichloroethenyl)-5,5-dimethyloxolan-2-one is sourced from PubChem (CID 5091449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).