C29H43NO6 — CID 50914517
[(1S)-4-methyl-1-(1,4,5,8-tetraethoxynaphthalen-2-yl)pent-3-enyl] 3-(dimethylamino)propanoate (PubChem CID 50914517) has the molecular formula C29H43NO6 and a molecular weight of 501.66 g/mol. Its IUPAC name is [(1S)-4-methyl-1-(1,4,5,8-tetraethoxynaphthalen-2-yl)pent-3-enyl] 3-(dimethylamino)propanoate.
| Compound Name | [(1S)-4-methyl-1-(1,4,5,8-tetraethoxynaphthalen-2-yl)pent-3-enyl] 3-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 50914517 |
| Molecular Formula | C29H43NO6 |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | [(1S)-4-methyl-1-(1,4,5,8-tetraethoxynaphthalen-2-yl)pent-3-enyl] 3-(dimethylamino)propanoate |
| SMILES | CCOc1ccc(OCC)c2c(OCC)c([C@H](CC=C(C)C)OC(=O)CCN(C)C)cc(OCC)c12 |
| InChI | InChI=1S/C29H43NO6/c1-9-32-23-15-16-24(33-10-2)28-27(23)25(34-11-3)19-21(29(28)35-12-4)22(14-13-20(5)6)36-26(31)17-18-30(7)8/h13,15-16,19,22H,9-12,14,17-18H2,1-8H3/t22-/m0/s1 |
| InChIKey | MXPSTYPZSMFDAB-QFIPXVFZSA-N |
| XLogP | 6.33 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|