C24H25Cl2N3O3 — CID 50914638
9-(3,5-dichlorophenyl)-3-(3,3-dimethylbutanoyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione (PubChem CID 50914638) has the molecular formula C24H25Cl2N3O3 and a molecular weight of 474.39 g/mol. Its IUPAC name is 9-(3,5-dichlorophenyl)-3-(3,3-dimethylbutanoyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione.
| Compound Name | 9-(3,5-dichlorophenyl)-3-(3,3-dimethylbutanoyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
|---|---|
| PubChem CID | 50914638 |
| Molecular Formula | C24H25Cl2N3O3 |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 9-(3,5-dichlorophenyl)-3-(3,3-dimethylbutanoyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
| SMILES | CC(C)(C)CC(=O)N1CCN2C(=O)c3cc(-c4cc(Cl)cc(Cl)c4)ccc3NC(=O)C2C1 |
| InChI | InChI=1S/C24H25Cl2N3O3/c1-24(2,3)12-21(30)28-6-7-29-20(13-28)22(31)27-19-5-4-14(10-18(19)23(29)32)15-8-16(25)11-17(26)9-15/h4-5,8-11,20H,6-7,12-13H2,1-3H3,(H,27,31) |
| InChIKey | OWILZGBBLIJJGM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |