C13H16N2O — CID 5091508
1',3',3'-trimethylspiro[4H-1,2-oxazole-5,2'-indole] (PubChem CID 5091508) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 1',3',3'-trimethylspiro[4H-1,2-oxazole-5,2'-indole].
| Compound Name | 1',3',3'-trimethylspiro[4H-1,2-oxazole-5,2'-indole] |
|---|---|
| PubChem CID | 5091508 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1',3',3'-trimethylspiro[4H-1,2-oxazole-5,2'-indole] |
| SMILES | CN1c2ccccc2C(C)(C)C12CC=NO2 |
| InChI | InChI=1S/C13H16N2O/c1-12(2)10-6-4-5-7-11(10)15(3)13(12)8-9-14-16-13/h4-7,9H,8H2,1-3H3 |
| InChIKey | SELZFPWJTBQJEE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |