C25H33N9O5S3 — CID 50915134
(2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[(2-piperazin-1-yl-1,3-thiazol-4-yl)methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 50915134) has the molecular formula C25H33N9O5S3 and a molecular weight of 635.80 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[(2-piperazin-1-yl-1,3-thiazol-4-yl)methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[(2-piperazin-1-yl-1,3-thiazol-4-yl)methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 50915134 |
| Molecular Formula | C25H33N9O5S3 |
| Molecular Weight | 635.80 g/mol |
| Exact Mass | 635.18 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[(2-piperazin-1-yl-1,3-thiazol-4-yl)methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1sccc1NS(=O)(=O)c1cccc(NCc2csc(N3CCNCC3)n2)c1)C(=O)O |
| InChI | InChI=1S/C25H33N9O5S3/c26-24(27)29-7-2-5-20(23(36)37)32-22(35)21-19(6-12-40-21)33-42(38,39)18-4-1-3-16(13-18)30-14-17-15-41-25(31-17)34-10-8-28-9-11-34/h1,3-4,6,12-13,15,20,28,30,33H,2,5,7-11,14H2,(H,32,35)(H,36,37)(H4,26,27,29)/t20-/m0/s1 |
| InChIKey | ASZRCNQCFLHESI-FQEVSTJZSA-N |
| XLogP | 1.26 |
| TPSA | 217.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.80 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|