C30H49NO4Si2 — CID 50915354
(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-N,N-dimethylpentanamide (PubChem CID 50915354) has the molecular formula C30H49NO4Si2 and a molecular weight of 543.90 g/mol. Its IUPAC name is (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-N,N-dimethylpentanamide.
| Compound Name | (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-N,N-dimethylpentanamide |
|---|---|
| PubChem CID | 50915354 |
| Molecular Formula | C30H49NO4Si2 |
| Molecular Weight | 543.90 g/mol |
| Exact Mass | 543.32 |
| IUPAC Name | (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-N,N-dimethylpentanamide |
| SMILES | CC(O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)N(C)C |
| InChI | InChI=1S/C30H49NO4Si2/c1-23(32)27(35-36(10,11)29(2,3)4)26(28(33)31(8)9)22-34-37(30(5,6)7,24-18-14-12-15-19-24)25-20-16-13-17-21-25/h12-21,23,26-27,32H,22H2,1-11H3/t23?,26-,27+/m0/s1 |
| InChIKey | UUUXXGUAIIOCIP-AUHZSHLXSA-N |
| XLogP | 5.04 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.90 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|