C20H30O4 — CID 50915560
(1S,4R,7R,9S,11S,13R)-7,13-bis(prop-1-en-2-yl)-10,16-dioxatetracyclo[7.6.1.01,11.04,9]hexadecane-4,11-diol (PubChem CID 50915560) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1S,4R,7R,9S,11S,13R)-7,13-bis(prop-1-en-2-yl)-10,16-dioxatetracyclo[7.6.1.01,11.04,9]hexadecane-4,11-diol.
| Compound Name | (1S,4R,7R,9S,11S,13R)-7,13-bis(prop-1-en-2-yl)-10,16-dioxatetracyclo[7.6.1.01,11.04,9]hexadecane-4,11-diol |
|---|---|
| PubChem CID | 50915560 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1S,4R,7R,9S,11S,13R)-7,13-bis(prop-1-en-2-yl)-10,16-dioxatetracyclo[7.6.1.01,11.04,9]hexadecane-4,11-diol |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(O)CC[C@@]34CC[C@@H](C(=C)C)C[C@]3(O)O[C@]2(C1)O4 |
| InChI | InChI=1S/C20H30O4/c1-13(2)15-6-8-18-10-9-17(21)7-5-16(14(3)4)12-20(17,23-18)24-19(18,22)11-15/h15-16,21-22H,1,3,5-12H2,2,4H3/t15-,16-,17-,18+,19+,20+/m1/s1 |
| InChIKey | PEUJAEIFSGTESD-MUJBESKKSA-N |
| XLogP | 3.43 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|