C24H26ClN7O2 — CID 50915802
3-chloro-N-methyl-5-(methylamino)-4-[4-[(7-oxo-6,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-11-yl)methyl]piperazin-1-yl]benzamide (PubChem CID 50915802) has the molecular formula C24H26ClN7O2 and a molecular weight of 479.97 g/mol. Its IUPAC name is 3-chloro-N-methyl-5-(methylamino)-4-[4-[(7-oxo-6,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-11-yl)methyl]piperazin-1-yl]benzamide.
| Compound Name | 3-chloro-N-methyl-5-(methylamino)-4-[4-[(7-oxo-6,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-11-yl)methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 50915802 |
| Molecular Formula | C24H26ClN7O2 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 3-chloro-N-methyl-5-(methylamino)-4-[4-[(7-oxo-6,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-11-yl)methyl]piperazin-1-yl]benzamide |
| SMILES | CNC(=O)c1cc(Cl)c(N2CCN(Cc3cnc4c(c3)[nH]c(=O)n3cccc43)CC2)c(NC)c1 |
| InChI | InChI=1S/C24H26ClN7O2/c1-26-19-12-16(23(33)27-2)11-17(25)22(19)31-8-6-30(7-9-31)14-15-10-18-21(28-13-15)20-4-3-5-32(20)24(34)29-18/h3-5,10-13,26H,6-9,14H2,1-2H3,(H,27,33)(H,29,34) |
| InChIKey | ZDSVSSHDYBWTLS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |