C25H30O7 — CID 50915872
diethyl 4-(4-hydroxy-3,5-dimethoxyphenyl)-4-methyl-1,3-dihydronaphthalene-2,2-dicarboxylate (PubChem CID 50915872) has the molecular formula C25H30O7 and a molecular weight of 442.51 g/mol. Its IUPAC name is diethyl 4-(4-hydroxy-3,5-dimethoxyphenyl)-4-methyl-1,3-dihydronaphthalene-2,2-dicarboxylate.
| Compound Name | diethyl 4-(4-hydroxy-3,5-dimethoxyphenyl)-4-methyl-1,3-dihydronaphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 50915872 |
| Molecular Formula | C25H30O7 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | diethyl 4-(4-hydroxy-3,5-dimethoxyphenyl)-4-methyl-1,3-dihydronaphthalene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2ccccc2C(C)(c2cc(OC)c(O)c(OC)c2)C1 |
| InChI | InChI=1S/C25H30O7/c1-6-31-22(27)25(23(28)32-7-2)14-16-10-8-9-11-18(16)24(3,15-25)17-12-19(29-4)21(26)20(13-17)30-5/h8-13,26H,6-7,14-15H2,1-5H3 |
| InChIKey | XPMHKXUZPJQKGH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|