C36H38N8O5 — CID 50915921
tert-butyl N-[4-[[1-methyl-4-[[1-methyl-4-(pyrene-1-carbonylamino)imidazole-2-carbonyl]amino]imidazole-2-carbonyl]amino]butyl]carbamate (PubChem CID 50915921) has the molecular formula C36H38N8O5 and a molecular weight of 662.75 g/mol. Its IUPAC name is tert-butyl N-[4-[[1-methyl-4-[[1-methyl-4-(pyrene-1-carbonylamino)imidazole-2-carbonyl]amino]imidazole-2-carbonyl]amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[1-methyl-4-[[1-methyl-4-(pyrene-1-carbonylamino)imidazole-2-carbonyl]amino]imidazole-2-carbonyl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 50915921 |
| Molecular Formula | C36H38N8O5 |
| Molecular Weight | 662.75 g/mol |
| Exact Mass | 662.30 |
| IUPAC Name | tert-butyl N-[4-[[1-methyl-4-[[1-methyl-4-(pyrene-1-carbonylamino)imidazole-2-carbonyl]amino]imidazole-2-carbonyl]amino]butyl]carbamate |
| SMILES | Cn1cc(NC(=O)c2nc(NC(=O)c3ccc4ccc5cccc6ccc3c4c56)cn2C)nc1C(=O)NCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H38N8O5/c1-36(2,3)49-35(48)38-18-7-6-17-37-33(46)30-39-27(20-43(30)4)42-34(47)31-40-26(19-44(31)5)41-32(45)25-16-14-23-12-11-21-9-8-10-22-13-15-24(25)29(23)28(21)22/h8-16,19-20H,6-7,17-18H2,1-5H3,(H,37,46)(H,38,48)(H,41,45)(H,42,47) |
| InChIKey | DLRAQASGHQICRH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 161.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.75 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|