C16H26 — CID 50916020
(5S,6R)-5-ethynyl-2,6,10-trimethylundeca-1,9-diene (PubChem CID 50916020) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is (5S,6R)-5-ethynyl-2,6,10-trimethylundeca-1,9-diene.
| Compound Name | (5S,6R)-5-ethynyl-2,6,10-trimethylundeca-1,9-diene |
|---|---|
| PubChem CID | 50916020 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | (5S,6R)-5-ethynyl-2,6,10-trimethylundeca-1,9-diene |
| SMILES | C#C[C@@H](CCC(=C)C)[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C16H26/c1-7-16(12-11-14(4)5)15(6)10-8-9-13(2)3/h1,9,15-16H,4,8,10-12H2,2-3,5-6H3/t15-,16+/m1/s1 |
| InChIKey | HPUAJMQYPFTUCC-CVEARBPZSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|