C13H19N5O11P2 — CID 50916470
(2R,3R,4S,5R)-23-amino-8-hydroxy-10-oxido-8,10-dioxo-7,9,11,14,24-pentaoxa-16,18,21-triaza-1-azonia-8λ5,10λ5-diphosphatetracyclo[17.3.1.12,5.016,20]tetracosa-1(23),17,19,21-tetraene-3,4-diol (PubChem CID 50916470) has the molecular formula C13H19N5O11P2 and a molecular weight of 483.27 g/mol. Its IUPAC name is (2R,3R,4S,5R)-23-amino-8-hydroxy-10-oxido-8,10-dioxo-7,9,11,14,24-pentaoxa-16,18,21-triaza-1-azonia-8λ5,10λ5-diphosphatetracyclo[17.3.1.12,5.016,20]tetracosa-1(23),17,19,21-tetraene-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-23-amino-8-hydroxy-10-oxido-8,10-dioxo-7,9,11,14,24-pentaoxa-16,18,21-triaza-1-azonia-8λ5,10λ5-diphosphatetracyclo[17.3.1.12,5.016,20]tetracosa-1(23),17,19,21-tetraene-3,4-diol |
|---|---|
| PubChem CID | 50916470 |
| Molecular Formula | C13H19N5O11P2 |
| Molecular Weight | 483.27 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | (2R,3R,4S,5R)-23-amino-8-hydroxy-10-oxido-8,10-dioxo-7,9,11,14,24-pentaoxa-16,18,21-triaza-1-azonia-8λ5,10λ5-diphosphatetracyclo[17.3.1.12,5.016,20]tetracosa-1(23),17,19,21-tetraene-3,4-diol |
| SMILES | Nc1c2ncn3c2nc[n+]1[C@@H]1O[C@H](COP(=O)(O)OP(=O)([O-])OCCOC3)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H19N5O11P2/c14-11-8-12-16-5-18(11)13-10(20)9(19)7(28-13)3-27-31(23,24)29-30(21,22)26-2-1-25-6-17(12)4-15-8/h4-5,7,9-10,13-14,19-20H,1-3,6H2,(H2,21,22,23,24)/t7-,9-,10-,13-/m1/s1 |
| InChIKey | JBSUHBFSOOYXOR-QYVSTXNMSA-N |
| XLogP | -2.47 |
| TPSA | 224.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.27 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|