About 2-(4-methylphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline
2-(4-methylphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 50916710) has the molecular formula C20H14N4
and a molecular weight of 310.36 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline |
| PubChem CID | 50916710 |
| Molecular Formula | C20H14N4 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-(4-methylphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | Cc1ccc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)cc1 |
| InChI | InChI=1S/C20H14N4/c1-12-6-8-13(9-7-12)20-23-18-14-4-2-10-21-16(14)17-15(19(18)24-20)5-3-11-22-17/h2-11H,1H3,(H,23,24) |
| InChIKey | IMFIANATLACFFL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline?
The IUPAC name of 2-(4-methylphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline (CID 50916710) is 2-(4-methylphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline.
What is the SMILES notation for 2-(4-methylphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline?
The canonical SMILES for 2-(4-methylphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline is Cc1ccc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)cc1.
What is the InChIKey of 2-(4-methylphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline?
The InChIKey is IMFIANATLACFFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N4/c1-12-6-8-13(9-7-12)20-23-18-14-4-2-10-21-16(14)17-15(19(18)24-20)5-3-11-22-17/h2-11H,1H3,(H,23,24).
What are the key properties of 2-(4-methylphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline?
2-(4-methylphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline has a molecular weight of 310.36 g/mol, XLogP of 4.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline is sourced from PubChem (CID 50916710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).