About 2-benzamidobenzoate
2-benzamidobenzoate (PubChem CID 5091716) has the molecular formula C14H10NO3-
and a molecular weight of 240.24 g/mol. Its IUPAC name is 2-benzamidobenzoate.
Molecular Properties
| Compound Name | 2-benzamidobenzoate |
| PubChem CID | 5091716 |
| Molecular Formula | C14H10NO3- |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-benzamidobenzoate |
| SMILES | O=C(Nc1ccccc1C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C14H11NO3/c16-13(10-6-2-1-3-7-10)15-12-9-5-4-8-11(12)14(17)18/h1-9H,(H,15,16)(H,17,18)/p-1 |
| InChIKey | WXVLIIDDWFGYCV-UHFFFAOYSA-M |
| XLogP | 1.30 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzamidobenzoate?
The IUPAC name of 2-benzamidobenzoate (CID 5091716) is 2-benzamidobenzoate.
What is the SMILES notation for 2-benzamidobenzoate?
The canonical SMILES for 2-benzamidobenzoate is O=C(Nc1ccccc1C(=O)[O-])c1ccccc1.
What is the InChIKey of 2-benzamidobenzoate?
The InChIKey is WXVLIIDDWFGYCV-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H11NO3/c16-13(10-6-2-1-3-7-10)15-12-9-5-4-8-11(12)14(17)18/h1-9H,(H,15,16)(H,17,18)/p-1.
What are the key properties of 2-benzamidobenzoate?
2-benzamidobenzoate has a molecular weight of 240.24 g/mol, XLogP of 1.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzamidobenzoate is sourced from PubChem (CID 5091716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).