About 2-hydroxy-3,4,5-trioxocyclopenten-1-olate
2-hydroxy-3,4,5-trioxocyclopenten-1-olate (PubChem CID 5091734) has the molecular formula C5HO5-
and a molecular weight of 141.06 g/mol. Its IUPAC name is 2-hydroxy-3,4,5-trioxocyclopenten-1-olate.
Molecular Properties
| Compound Name | 2-hydroxy-3,4,5-trioxocyclopenten-1-olate |
| PubChem CID | 5091734 |
| Molecular Formula | C5HO5- |
| Molecular Weight | 141.06 g/mol |
| Exact Mass | 140.98 |
| IUPAC Name | 2-hydroxy-3,4,5-trioxocyclopenten-1-olate |
| SMILES | O=c1c([O-])c(O)c(=O)c1=O |
| InChI | InChI=1S/C5H2O5/c6-1-2(7)4(9)5(10)3(1)8/h6-7H/p-1 |
| InChIKey | RBSLJAJQOVYTRQ-UHFFFAOYSA-M |
| XLogP | -2.58 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.06 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3,4,5-trioxocyclopenten-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3,4,5-trioxocyclopenten-1-olate?
The IUPAC name of 2-hydroxy-3,4,5-trioxocyclopenten-1-olate (CID 5091734) is 2-hydroxy-3,4,5-trioxocyclopenten-1-olate.
What is the SMILES notation for 2-hydroxy-3,4,5-trioxocyclopenten-1-olate?
The canonical SMILES for 2-hydroxy-3,4,5-trioxocyclopenten-1-olate is O=c1c([O-])c(O)c(=O)c1=O.
What is the InChIKey of 2-hydroxy-3,4,5-trioxocyclopenten-1-olate?
The InChIKey is RBSLJAJQOVYTRQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H2O5/c6-1-2(7)4(9)5(10)3(1)8/h6-7H/p-1.
What are the key properties of 2-hydroxy-3,4,5-trioxocyclopenten-1-olate?
2-hydroxy-3,4,5-trioxocyclopenten-1-olate has a molecular weight of 141.06 g/mol, XLogP of -2.58, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3,4,5-trioxocyclopenten-1-olate is sourced from PubChem (CID 5091734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).