C17H14FeO2 — CID 50918245
cyclopenta-1,3-diene;3-cyclopenta-1,4-dien-1-ylbenzoic acid;iron(2+) (PubChem CID 50918245) has the molecular formula C17H14FeO2 and a molecular weight of 306.14 g/mol. Its IUPAC name is cyclopenta-1,3-diene;3-cyclopenta-1,4-dien-1-ylbenzoic acid;iron(2+).
| Compound Name | cyclopenta-1,3-diene;3-cyclopenta-1,4-dien-1-ylbenzoic acid;iron(2+) |
|---|---|
| PubChem CID | 50918245 |
| Molecular Formula | C17H14FeO2 |
| Molecular Weight | 306.14 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | cyclopenta-1,3-diene;3-cyclopenta-1,4-dien-1-ylbenzoic acid;iron(2+) |
| SMILES | O=C(O)c1cccc(-c2cc[cH-]c2)c1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C12H9O2.C5H5.Fe/c13-12(14)11-7-3-6-10(8-11)9-4-1-2-5-9;1-2-4-5-3-1;/h1-8H,(H,13,14);1-5H;/q2*-1;+2 |
| InChIKey | SIWCMXCJLZIVGZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.14 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|