About copper;bis(methyl N-(2-methylpropylideneamino)carbamodithioate)
copper;bis(methyl N-(2-methylpropylideneamino)carbamodithioate) (PubChem CID 50918431) has the molecular formula C12H24CuN4S4
and a molecular weight of 416.17 g/mol. Its IUPAC name is copper;bis(methyl N-(2-methylpropylideneamino)carbamodithioate).
Molecular Properties
| Compound Name | copper;bis(methyl N-(2-methylpropylideneamino)carbamodithioate) |
| PubChem CID | 50918431 |
| Molecular Formula | C12H24CuN4S4 |
| Molecular Weight | 416.17 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | copper;bis(methyl N-(2-methylpropylideneamino)carbamodithioate) |
| SMILES | CSC(=S)NN=CC(C)C.CSC(=S)NN=CC(C)C.[Cu] |
| InChI | InChI=1S/2C6H12N2S2.Cu/c2*1-5(2)4-7-8-6(9)10-3;/h2*4-5H,1-3H3,(H,8,9); |
| InChIKey | COJXIFQBYLMPOA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.17 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze copper;bis(methyl N-(2-methylpropylideneamino)carbamodithioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis(methyl N-(2-methylpropylideneamino)carbamodithioate)?
The IUPAC name of copper;bis(methyl N-(2-methylpropylideneamino)carbamodithioate) (CID 50918431) is copper;bis(methyl N-(2-methylpropylideneamino)carbamodithioate).
What is the SMILES notation for copper;bis(methyl N-(2-methylpropylideneamino)carbamodithioate)?
The canonical SMILES for copper;bis(methyl N-(2-methylpropylideneamino)carbamodithioate) is CSC(=S)NN=CC(C)C.CSC(=S)NN=CC(C)C.[Cu].
What is the InChIKey of copper;bis(methyl N-(2-methylpropylideneamino)carbamodithioate)?
The InChIKey is COJXIFQBYLMPOA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H12N2S2.Cu/c2*1-5(2)4-7-8-6(9)10-3;/h2*4-5H,1-3H3,(H,8,9);.
What are the key properties of copper;bis(methyl N-(2-methylpropylideneamino)carbamodithioate)?
copper;bis(methyl N-(2-methylpropylideneamino)carbamodithioate) has a molecular weight of 416.17 g/mol, XLogP of 3.73, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis(methyl N-(2-methylpropylideneamino)carbamodithioate) is sourced from PubChem (CID 50918431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).