About (1S,4S)-2,3-dimethylidenebicyclo[2.2.1]heptane
(1S,4S)-2,3-dimethylidenebicyclo[2.2.1]heptane (PubChem CID 50919081) has the molecular formula C9H12
and a molecular weight of 120.19 g/mol. Its IUPAC name is (1S,4S)-2,3-dimethylidenebicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | (1S,4S)-2,3-dimethylidenebicyclo[2.2.1]heptane |
| PubChem CID | 50919081 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | (1S,4S)-2,3-dimethylidenebicyclo[2.2.1]heptane |
| SMILES | C=C1C(=C)[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C9H12/c1-6-7(2)9-4-3-8(6)5-9/h8-9H,1-5H2/t8-,9-/m0/s1 |
| InChIKey | GUBNJQWOCZEVSJ-IUCAKERBSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1S,4S)-2,3-dimethylidenebicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4S)-2,3-dimethylidenebicyclo[2.2.1]heptane?
The IUPAC name of (1S,4S)-2,3-dimethylidenebicyclo[2.2.1]heptane (CID 50919081) is (1S,4S)-2,3-dimethylidenebicyclo[2.2.1]heptane.
What is the SMILES notation for (1S,4S)-2,3-dimethylidenebicyclo[2.2.1]heptane?
The canonical SMILES for (1S,4S)-2,3-dimethylidenebicyclo[2.2.1]heptane is C=C1C(=C)[C@H]2CC[C@H]1C2.
What is the InChIKey of (1S,4S)-2,3-dimethylidenebicyclo[2.2.1]heptane?
The InChIKey is GUBNJQWOCZEVSJ-IUCAKERBSA-N. The full InChI is InChI=1S/C9H12/c1-6-7(2)9-4-3-8(6)5-9/h8-9H,1-5H2/t8-,9-/m0/s1.
What are the key properties of (1S,4S)-2,3-dimethylidenebicyclo[2.2.1]heptane?
(1S,4S)-2,3-dimethylidenebicyclo[2.2.1]heptane has a molecular weight of 120.19 g/mol, XLogP of 2.53, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4S)-2,3-dimethylidenebicyclo[2.2.1]heptane is sourced from PubChem (CID 50919081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).