C23H27NO3S — CID 50919291
(1S,4S,7S)-5-methylidene-3-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-3-azabicyclo[5.1.0]octane (PubChem CID 50919291) has the molecular formula C23H27NO3S and a molecular weight of 397.54 g/mol. Its IUPAC name is (1S,4S,7S)-5-methylidene-3-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-3-azabicyclo[5.1.0]octane.
| Compound Name | (1S,4S,7S)-5-methylidene-3-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-3-azabicyclo[5.1.0]octane |
|---|---|
| PubChem CID | 50919291 |
| Molecular Formula | C23H27NO3S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (1S,4S,7S)-5-methylidene-3-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-3-azabicyclo[5.1.0]octane |
| SMILES | C=C1C[C@@H]2C[C@@H]2CN(S(=O)(=O)c2ccc(C)cc2)[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C23H27NO3S/c1-17-8-10-22(11-9-17)28(25,26)24-14-21-13-20(21)12-18(2)23(24)16-27-15-19-6-4-3-5-7-19/h3-11,20-21,23H,2,12-16H2,1H3/t20-,21-,23-/m1/s1 |
| InChIKey | JIBFEAKMEZDBFV-MQSCRBSSSA-N |
| XLogP | 4.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|