About bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+)
bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+) (PubChem CID 50919456) has the molecular formula C26H24Cl2N4NiO2+4
and a molecular weight of 554.10 g/mol. Its IUPAC name is bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+).
Molecular Properties
| Compound Name | bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+) |
| PubChem CID | 50919456 |
| Molecular Formula | C26H24Cl2N4NiO2+4 |
| Molecular Weight | 554.10 g/mol |
| Exact Mass | 552.06 |
| IUPAC Name | bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+) |
| SMILES | [Ni+2].[OH2+]c1ccc(Cl)cc1/C=N/Cc1ccccn1.[OH2+]c1ccc(Cl)cc1/C=N/Cc1ccccn1 |
| InChI | InChI=1S/2C13H11ClN2O.Ni/c2*14-11-4-5-13(17)10(7-11)8-15-9-12-3-1-2-6-16-12;/h2*1-8,17H,9H2;/q;;+2/p+2/b2*15-8+; |
| InChIKey | GPRZCPFZVAYXLI-ILRJJWRASA-P |
| XLogP | 5.58 |
| TPSA | 96.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.10 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+)?
The IUPAC name of bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+) (CID 50919456) is bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+).
What is the SMILES notation for bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+)?
The canonical SMILES for bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+) is [Ni+2].[OH2+]c1ccc(Cl)cc1/C=N/Cc1ccccn1.[OH2+]c1ccc(Cl)cc1/C=N/Cc1ccccn1.
What is the InChIKey of bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+)?
The InChIKey is GPRZCPFZVAYXLI-ILRJJWRASA-P. The full InChI is InChI=1S/2C13H11ClN2O.Ni/c2*14-11-4-5-13(17)10(7-11)8-15-9-12-3-1-2-6-16-12;/h2*1-8,17H,9H2;/q;;+2/p+2/b2*15-8+;.
What are the key properties of bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+)?
bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+) has a molecular weight of 554.10 g/mol, XLogP of 5.58, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+) is sourced from PubChem (CID 50919456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).