C25H26FeN2O2 — CID 50921499
cyclopenta-1,3-diene;ethyl (Z)-3-(3-cyclopenta-2,4-dien-1-ylidene-5-phenylpyrazolidin-2-id-1-yl)but-2-enoate;iron(2+) (PubChem CID 50921499) has the molecular formula C25H26FeN2O2 and a molecular weight of 442.34 g/mol. Its IUPAC name is cyclopenta-1,3-diene;ethyl (Z)-3-(3-cyclopenta-2,4-dien-1-ylidene-5-phenylpyrazolidin-2-id-1-yl)but-2-enoate;iron(2+).
| Compound Name | cyclopenta-1,3-diene;ethyl (Z)-3-(3-cyclopenta-2,4-dien-1-ylidene-5-phenylpyrazolidin-2-id-1-yl)but-2-enoate;iron(2+) |
|---|---|
| PubChem CID | 50921499 |
| Molecular Formula | C25H26FeN2O2 |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | cyclopenta-1,3-diene;ethyl (Z)-3-(3-cyclopenta-2,4-dien-1-ylidene-5-phenylpyrazolidin-2-id-1-yl)but-2-enoate;iron(2+) |
| SMILES | CCOC(=O)/C=C(/C)N1[N-]C(=C2C=CC=C2)CC1c1ccccc1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C20H21N2O2.C5H5.Fe/c1-3-24-20(23)13-15(2)22-19(17-11-5-4-6-12-17)14-18(21-22)16-9-7-8-10-16;1-2-4-5-3-1;/h4-13,19H,3,14H2,1-2H3;1-5H;/q2*-1;+2/b15-13-;; |
| InChIKey | JAHJFECRGDUNPB-FQGJLALVSA-N |
| XLogP | 5.97 |
| TPSA | 43.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|