C33H42O5Si — CID 50922766
tert-butyl-[(R)-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethoxy]-diphenylsilane (PubChem CID 50922766) has the molecular formula C33H42O5Si and a molecular weight of 546.78 g/mol. Its IUPAC name is tert-butyl-[(R)-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(R)-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 50922766 |
| Molecular Formula | C33H42O5Si |
| Molecular Weight | 546.78 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | tert-butyl-[(R)-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethoxy]-diphenylsilane |
| SMILES | CC1(C)O[C@H]([C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c2ccccc2)[C@@H]([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C33H42O5Si/c1-31(2,3)39(25-19-13-9-14-20-25,26-21-15-10-16-22-26)38-28(24-17-11-8-12-18-24)30-29(36-33(6,7)37-30)27-23-34-32(4,5)35-27/h8-22,27-30H,23H2,1-7H3/t27-,28-,29-,30-/m1/s1 |
| InChIKey | DQCSWLPMPDEGRD-SKKKGAJSSA-N |
| XLogP | 5.98 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.78 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|