About [(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate
[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate (PubChem CID 50922793) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is [(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate.
Molecular Properties
| Compound Name | [(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate |
| PubChem CID | 50922793 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | [(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate |
| SMILES | C=CC[C@@H](OC(=O)C=C)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C12H18O4/c1-5-7-9(15-11(13)6-2)10-8-14-12(3,4)16-10/h5-6,9-10H,1-2,7-8H2,3-4H3/t9-,10+/m1/s1 |
| InChIKey | XPAIIIRLKZVTDW-ZJUUUORDSA-N |
| XLogP | 1.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate?
The IUPAC name of [(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate (CID 50922793) is [(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate.
What is the SMILES notation for [(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate?
The canonical SMILES for [(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate is C=CC[C@@H](OC(=O)C=C)[C@@H]1COC(C)(C)O1.
What is the InChIKey of [(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate?
The InChIKey is XPAIIIRLKZVTDW-ZJUUUORDSA-N. The full InChI is InChI=1S/C12H18O4/c1-5-7-9(15-11(13)6-2)10-8-14-12(3,4)16-10/h5-6,9-10H,1-2,7-8H2,3-4H3/t9-,10+/m1/s1.
What are the key properties of [(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate?
[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate has a molecular weight of 226.27 g/mol, XLogP of 1.81, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate is sourced from PubChem (CID 50922793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).