C10H20O2 — CID 50922812
(4S,5S)-2,2,4-triethyl-5-methyl-1,3-dioxolane (PubChem CID 50922812) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is (4S,5S)-2,2,4-triethyl-5-methyl-1,3-dioxolane.
| Compound Name | (4S,5S)-2,2,4-triethyl-5-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 50922812 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | (4S,5S)-2,2,4-triethyl-5-methyl-1,3-dioxolane |
| SMILES | CC[C@@H]1OC(CC)(CC)O[C@H]1C |
| InChI | InChI=1S/C10H20O2/c1-5-9-8(4)11-10(6-2,7-3)12-9/h8-9H,5-7H2,1-4H3/t8-,9-/m0/s1 |
| InChIKey | YGCDEVNIIFDSNC-IUCAKERBSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |